C10H14N4O3S — CID 134208778
[1-(2-amino-1,3-thiazole-4-carbonyl)piperidin-4-yl]carbamic acid (PubChem CID 134208778) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is [1-(2-amino-1,3-thiazole-4-carbonyl)piperidin-4-yl]carbamic acid.
| Compound Name | [1-(2-amino-1,3-thiazole-4-carbonyl)piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 134208778 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [1-(2-amino-1,3-thiazole-4-carbonyl)piperidin-4-yl]carbamic acid |
| SMILES | Nc1nc(C(=O)N2CCC(NC(=O)O)CC2)cs1 |
| InChI | InChI=1S/C10H14N4O3S/c11-9-13-7(5-18-9)8(15)14-3-1-6(2-4-14)12-10(16)17/h5-6,12H,1-4H2,(H2,11,13)(H,16,17) |
| InChIKey | XXSXUSWSPRRWTL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |