C9H11N3OS — CID 114408809
(2-amino-1,3-thiazol-4-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114408809) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (2-amino-1,3-thiazol-4-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114408809 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | Nc1nc(C(=O)N2CC=CCC2)cs1 |
| InChI | InChI=1S/C9H11N3OS/c10-9-11-7(6-14-9)8(13)12-4-2-1-3-5-12/h1-2,6H,3-5H2,(H2,10,11) |
| InChIKey | ROTFMGFWDJGXSD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|