C23H25ClN4O2 — CID 171713342
[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-5-ylmethanone;hydrochloride (PubChem CID 171713342) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is [(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-5-ylmethanone;hydrochloride.
| Compound Name | [(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-5-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 171713342 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-5-ylmethanone;hydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(C(=O)c4cccc5nccnc45)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C23H24N4O2.ClH/c1-26-12-16-13-27(14-19(16)22(26)15-6-8-17(29-2)9-7-15)23(28)18-4-3-5-20-21(18)25-11-10-24-20;/h3-11,16,19,22H,12-14H2,1-2H3;1H/t16-,19+,22-;/m0./s1 |
| InChIKey | JEPREELKNFMZRB-KPJWXIMOSA-N |
| XLogP | 3.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |