C26H28FN3O3 — CID 171912406
[5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 171912406) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171912406 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(Oc4ccc(CCN)cc4)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C26H28FN3O3/c1-32-21-8-4-20(5-9-21)29-14-16-30(17-15-29)26(31)24-18-23(10-11-25(24)27)33-22-6-2-19(3-7-22)12-13-28/h2-11,18H,12-17,28H2,1H3 |
| InChIKey | BNYNPKZKDXCIDG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|