C25H32FN3O2 — CID 171907703
[5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone (PubChem CID 171907703) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 171907703 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
| SMILES | NCCc1ccc(Oc2ccc(F)c(C(=O)N3CCC(N4CCCCC4)CC3)c2)cc1 |
| InChI | InChI=1S/C25H32FN3O2/c26-24-9-8-22(31-21-6-4-19(5-7-21)10-13-27)18-23(24)25(30)29-16-11-20(12-17-29)28-14-2-1-3-15-28/h4-9,18,20H,1-3,10-17,27H2 |
| InChIKey | YUUSHVWHKRRZHO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |