C22H28FN3O2 — CID 171388740
[5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 171388740) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 171388740 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | [5-[4-(2-aminoethyl)phenoxy]-2-fluorophenyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)c2cc(Oc3ccc(CCN)cc3)ccc2F)CC1 |
| InChI | InChI=1S/C22H28FN3O2/c1-16(2)25-11-13-26(14-12-25)22(27)20-15-19(7-8-21(20)23)28-18-5-3-17(4-6-18)9-10-24/h3-8,15-16H,9-14,24H2,1-2H3 |
| InChIKey | OIBSBQZWEJDIBU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |