C23H28FN3O3 — CID 171389634
N-[(1-acetylpiperidin-4-yl)methyl]-5-[4-(2-aminoethyl)phenoxy]-2-fluorobenzamide (PubChem CID 171389634) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is N-[(1-acetylpiperidin-4-yl)methyl]-5-[4-(2-aminoethyl)phenoxy]-2-fluorobenzamide.
| Compound Name | N-[(1-acetylpiperidin-4-yl)methyl]-5-[4-(2-aminoethyl)phenoxy]-2-fluorobenzamide |
|---|---|
| PubChem CID | 171389634 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[(1-acetylpiperidin-4-yl)methyl]-5-[4-(2-aminoethyl)phenoxy]-2-fluorobenzamide |
| SMILES | CC(=O)N1CCC(CNC(=O)c2cc(Oc3ccc(CCN)cc3)ccc2F)CC1 |
| InChI | InChI=1S/C23H28FN3O3/c1-16(28)27-12-9-18(10-13-27)15-26-23(29)21-14-20(6-7-22(21)24)30-19-4-2-17(3-5-19)8-11-25/h2-7,14,18H,8-13,15,25H2,1H3,(H,26,29) |
| InChIKey | OJDXHNSNIFLNSH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |