C20H23FN2O4 — CID 171911804
5-[4-(2-aminoethyl)phenoxy]-N-(1,4-dioxan-2-ylmethyl)-2-fluorobenzamide (PubChem CID 171911804) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-N-(1,4-dioxan-2-ylmethyl)-2-fluorobenzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-N-(1,4-dioxan-2-ylmethyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 171911804 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-N-(1,4-dioxan-2-ylmethyl)-2-fluorobenzamide |
| SMILES | NCCc1ccc(Oc2ccc(F)c(C(=O)NCC3COCCO3)c2)cc1 |
| InChI | InChI=1S/C20H23FN2O4/c21-19-6-5-16(27-15-3-1-14(2-4-15)7-8-22)11-18(19)20(24)23-12-17-13-25-9-10-26-17/h1-6,11,17H,7-10,12-13,22H2,(H,23,24) |
| InChIKey | QQUUBIZMKVUUHW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |