C21H23F3N2O2 — CID 172670767
5-[4-(2-aminoethyl)phenoxy]-N-(4,4-difluorocyclohexyl)-2-fluorobenzamide (PubChem CID 172670767) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-N-(4,4-difluorocyclohexyl)-2-fluorobenzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-N-(4,4-difluorocyclohexyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 172670767 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-N-(4,4-difluorocyclohexyl)-2-fluorobenzamide |
| SMILES | NCCc1ccc(Oc2ccc(F)c(C(=O)NC3CCC(F)(F)CC3)c2)cc1 |
| InChI | InChI=1S/C21H23F3N2O2/c22-19-6-5-17(28-16-3-1-14(2-4-16)9-12-25)13-18(19)20(27)26-15-7-10-21(23,24)11-8-15/h1-6,13,15H,7-12,25H2,(H,26,27) |
| InChIKey | ILFZFVYPXWQJRD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |