C18H27Cl2FN2O2 — CID 171330429
methyl 4-[(3R,3aS,6aR)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]butanoate;dihydrochloride (PubChem CID 171330429) has the molecular formula C18H27Cl2FN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is methyl 4-[(3R,3aS,6aR)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]butanoate;dihydrochloride.
| Compound Name | methyl 4-[(3R,3aS,6aR)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]butanoate;dihydrochloride |
|---|---|
| PubChem CID | 171330429 |
| Molecular Formula | C18H27Cl2FN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl 4-[(3R,3aS,6aR)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]butanoate;dihydrochloride |
| SMILES | COC(=O)CCCN1C[C@@H]2CN(C)[C@@H](c3cccc(F)c3)[C@@H]2C1.Cl.Cl |
| InChI | InChI=1S/C18H25FN2O2.2ClH/c1-20-10-14-11-21(8-4-7-17(22)23-2)12-16(14)18(20)13-5-3-6-15(19)9-13;;/h3,5-6,9,14,16,18H,4,7-8,10-12H2,1-2H3;2*1H/t14-,16+,18-;;/m0../s1 |
| InChIKey | UKROEEWAVYCZGL-QDICLJOVSA-N |
| XLogP | 3.16 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |