C21H23Cl2FN4OS — CID 171329921
[(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-benzothiazol-7-yl)methanone;dihydrochloride (PubChem CID 171329921) has the molecular formula C21H23Cl2FN4OS and a molecular weight of 469.41 g/mol. Its IUPAC name is [(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-benzothiazol-7-yl)methanone;dihydrochloride.
| Compound Name | [(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-benzothiazol-7-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171329921 |
| Molecular Formula | C21H23Cl2FN4OS |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-benzothiazol-7-yl)methanone;dihydrochloride |
| SMILES | CN1C[C@H]2CN(C(=O)c3cccc4nc(N)sc34)C[C@H]2[C@@H]1c1cccc(F)c1.Cl.Cl |
| InChI | InChI=1S/C21H21FN4OS.2ClH/c1-25-9-13-10-26(11-16(13)18(25)12-4-2-5-14(22)8-12)20(27)15-6-3-7-17-19(15)28-21(23)24-17;;/h2-8,13,16,18H,9-11H2,1H3,(H2,23,24);2*1H/t13-,16+,18-;;/m0../s1 |
| InChIKey | DHWCJXWEHXXCSL-FAVBWZHKSA-N |
| XLogP | 4.24 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |