C20H19F2N3O3S — CID 171325724
(2-amino-1,3-benzothiazol-7-yl)-[3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]methanone;formic acid (PubChem CID 171325724) has the molecular formula C20H19F2N3O3S and a molecular weight of 419.45 g/mol. Its IUPAC name is (2-amino-1,3-benzothiazol-7-yl)-[3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]methanone;formic acid.
| Compound Name | (2-amino-1,3-benzothiazol-7-yl)-[3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 171325724 |
| Molecular Formula | C20H19F2N3O3S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2-amino-1,3-benzothiazol-7-yl)-[3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]methanone;formic acid |
| SMILES | Nc1nc2cccc(C(=O)N3CCC(Cc4cc(F)cc(F)c4)C3)c2s1.O=CO |
| InChI | InChI=1S/C19H17F2N3OS.CH2O2/c20-13-7-12(8-14(21)9-13)6-11-4-5-24(10-11)18(25)15-2-1-3-16-17(15)26-19(22)23-16;2-1-3/h1-3,7-9,11H,4-6,10H2,(H2,22,23);1H,(H,2,3) |
| InChIKey | OAQFUJLHRMLWGO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|