C19H26F2N2O4 — CID 171709578
[3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-1-methylpiperidin-4-yl)methanone;formic acid (PubChem CID 171709578) has the molecular formula C19H26F2N2O4 and a molecular weight of 384.42 g/mol. Its IUPAC name is [3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-1-methylpiperidin-4-yl)methanone;formic acid.
| Compound Name | [3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-1-methylpiperidin-4-yl)methanone;formic acid |
|---|---|
| PubChem CID | 171709578 |
| Molecular Formula | C19H26F2N2O4 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [3-[(3,5-difluorophenyl)methyl]pyrrolidin-1-yl]-(4-hydroxy-1-methylpiperidin-4-yl)methanone;formic acid |
| SMILES | CN1CCC(O)(C(=O)N2CCC(Cc3cc(F)cc(F)c3)C2)CC1.O=CO |
| InChI | InChI=1S/C18H24F2N2O2.CH2O2/c1-21-6-3-18(24,4-7-21)17(23)22-5-2-13(12-22)8-14-9-15(19)11-16(20)10-14;2-1-3/h9-11,13,24H,2-8,12H2,1H3;1H,(H,2,3) |
| InChIKey | QBUIVOLGRZCZSY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|