C22H24ClFN2O3 — CID 171707728
[(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride (PubChem CID 171707728) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is [(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride.
| Compound Name | [(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171707728 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [(3R,3aS,6aS)-3-(3-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride |
| SMILES | CN1C[C@H]2CN(C(=O)c3cccc4c3OCCO4)C[C@H]2[C@@H]1c1cccc(F)c1.Cl |
| InChI | InChI=1S/C22H23FN2O3.ClH/c1-24-11-15-12-25(13-18(15)20(24)14-4-2-5-16(23)10-14)22(26)17-6-3-7-19-21(17)28-9-8-27-19;/h2-7,10,15,18,20H,8-9,11-13H2,1H3;1H/t15-,18+,20-;/m0./s1 |
| InChIKey | SMANERFFHGAEDD-DELGTOLHSA-N |
| XLogP | 3.39 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |