C24H22FN3O2 — CID 171389452
1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-5-(quinoline-8-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone (PubChem CID 171389452) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-5-(quinoline-8-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone.
| Compound Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-5-(quinoline-8-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 171389452 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-5-(quinoline-8-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2CN(C(=O)c3cccc4cccnc34)[C@@H](c3cccc(F)c3)[C@H]2C1 |
| InChI | InChI=1S/C24H22FN3O2/c1-15(29)27-12-18-13-28(23(21(18)14-27)17-6-2-8-19(25)11-17)24(30)20-9-3-5-16-7-4-10-26-22(16)20/h2-11,18,21,23H,12-14H2,1H3/t18-,21-,23-/m0/s1 |
| InChIKey | QPAAKKUDLUMJDS-HARLFGEKSA-N |
| XLogP | 3.67 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |