C21H27FN4O2 — CID 171912590
1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(2-imidazol-1-ylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone (PubChem CID 171912590) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(2-imidazol-1-ylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(2-imidazol-1-ylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 171912590 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(2-imidazol-1-ylethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1C[C@@H]2CN(CCn3ccnc3)C[C@@H]2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C21H27FN4O2/c1-2-28-14-20(27)26-12-17-11-25(9-8-24-7-6-23-15-24)13-19(17)21(26)16-4-3-5-18(22)10-16/h3-7,10,15,17,19,21H,2,8-9,11-14H2,1H3/t17-,19-,21+/m0/s1 |
| InChIKey | BPSVIBJRTGKKPZ-HFSMHLIXSA-N |
| XLogP | 2.19 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |