C15H18FN3O — CID 129480887
(3R,5S)-5-(3-fluorophenyl)-1-(2-imidazol-1-ylethyl)pyrrolidin-3-ol (PubChem CID 129480887) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is (3R,5S)-5-(3-fluorophenyl)-1-(2-imidazol-1-ylethyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(3-fluorophenyl)-1-(2-imidazol-1-ylethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129480887 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (3R,5S)-5-(3-fluorophenyl)-1-(2-imidazol-1-ylethyl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1C[C@@H](c2cccc(F)c2)N(CCn2ccnc2)C1 |
| InChI | InChI=1S/C15H18FN3O/c16-13-3-1-2-12(8-13)15-9-14(20)10-19(15)7-6-18-5-4-17-11-18/h1-5,8,11,14-15,20H,6-7,9-10H2/t14-,15+/m1/s1 |
| InChIKey | UYIVFUGUWHGXBD-CABCVRRESA-N |
| XLogP | 1.83 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |