About 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole
1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole (PubChem CID 124733917) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole.
Molecular Properties
| Compound Name | 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole |
| PubChem CID | 124733917 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole |
| SMILES | COc1cccc([C@H]2C[C@@H](C)CN2CCn2ccnc2)c1 |
| InChI | InChI=1S/C17H23N3O/c1-14-10-17(15-4-3-5-16(11-15)21-2)20(12-14)9-8-19-7-6-18-13-19/h3-7,11,13-14,17H,8-10,12H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | LUBNCXLQDUSJGG-RHSMWYFYSA-N |
| XLogP | 2.97 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole?
The IUPAC name of 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole (CID 124733917) is 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole.
What is the SMILES notation for 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole?
The canonical SMILES for 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole is COc1cccc([C@H]2C[C@@H](C)CN2CCn2ccnc2)c1.
What is the InChIKey of 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole?
The InChIKey is LUBNCXLQDUSJGG-RHSMWYFYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-14-10-17(15-4-3-5-16(11-15)21-2)20(12-14)9-8-19-7-6-18-13-19/h3-7,11,13-14,17H,8-10,12H2,1-2H3/t14-,17-/m1/s1.
What are the key properties of 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole?
1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole has a molecular weight of 285.39 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2R,4R)-2-(3-methoxyphenyl)-4-methylpyrrolidin-1-yl]ethyl]imidazole is sourced from PubChem (CID 124733917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).