C21H28N4O2S — CID 171385603
(3aR,4S,6aS)-5-cyclopropylsulfonyl-2-(2-imidazol-1-ylethyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 171385603) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-cyclopropylsulfonyl-2-(2-imidazol-1-ylethyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,4S,6aS)-5-cyclopropylsulfonyl-2-(2-imidazol-1-ylethyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 171385603 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (3aR,4S,6aS)-5-cyclopropylsulfonyl-2-(2-imidazol-1-ylethyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(CCn3ccnc3)C[C@H]2CN1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C21H28N4O2S/c1-16-4-2-3-5-19(16)21-20-14-24(11-10-23-9-8-22-15-23)12-17(20)13-25(21)28(26,27)18-6-7-18/h2-5,8-9,15,17-18,20-21H,6-7,10-14H2,1H3/t17-,20-,21+/m0/s1 |
| InChIKey | ZAXLOECAWRLLNQ-DZFGPLHGSA-N |
| XLogP | 2.29 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |