C16H21N3S — CID 124595047
1-[2-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]ethyl]imidazole (PubChem CID 124595047) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-[2-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]ethyl]imidazole.
| Compound Name | 1-[2-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]ethyl]imidazole |
|---|---|
| PubChem CID | 124595047 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-[2-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]ethyl]imidazole |
| SMILES | c1ccc(SC[C@@H]2CCN(CCn3ccnc3)C2)cc1 |
| InChI | InChI=1S/C16H21N3S/c1-2-4-16(5-3-1)20-13-15-6-8-18(12-15)10-11-19-9-7-17-14-19/h1-5,7,9,14-15H,6,8,10-13H2/t15-/m1/s1 |
| InChIKey | FPOBHXNAOWBOIN-OAHLLOKOSA-N |
| XLogP | 3.00 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |