C17H23N3S — CID 124784269
(3S,4R)-3-imidazol-1-yl-4-methyl-1-(2-phenylsulfanylethyl)piperidine (PubChem CID 124784269) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is (3S,4R)-3-imidazol-1-yl-4-methyl-1-(2-phenylsulfanylethyl)piperidine.
| Compound Name | (3S,4R)-3-imidazol-1-yl-4-methyl-1-(2-phenylsulfanylethyl)piperidine |
|---|---|
| PubChem CID | 124784269 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (3S,4R)-3-imidazol-1-yl-4-methyl-1-(2-phenylsulfanylethyl)piperidine |
| SMILES | C[C@@H]1CCN(CCSc2ccccc2)C[C@H]1n1ccnc1 |
| InChI | InChI=1S/C17H23N3S/c1-15-7-9-19(13-17(15)20-10-8-18-14-20)11-12-21-16-5-3-2-4-6-16/h2-6,8,10,14-15,17H,7,9,11-13H2,1H3/t15-,17-/m1/s1 |
| InChIKey | NRJWNEASDKXHSH-NVXWUHKLSA-N |
| XLogP | 3.56 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |