C19H23N5 — CID 75438067
3-imidazol-1-yl-4-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine (PubChem CID 75438067) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-imidazol-1-yl-4-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine.
| Compound Name | 3-imidazol-1-yl-4-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 75438067 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-imidazol-1-yl-4-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine |
| SMILES | CC1CCN(Cc2ccc(-n3cccn3)cc2)CC1n1ccnc1 |
| InChI | InChI=1S/C19H23N5/c1-16-7-11-22(14-19(16)23-12-9-20-15-23)13-17-3-5-18(6-4-17)24-10-2-8-21-24/h2-6,8-10,12,15-16,19H,7,11,13-14H2,1H3 |
| InChIKey | ZYTJSWGYRHMFTF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |