C24H36Cl2FN3O — CID 171330084
1-[(3aS,4S,6aR)-2-(3-azaspiro[5.5]undecan-9-yl)-4-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;dihydrochloride (PubChem CID 171330084) has the molecular formula C24H36Cl2FN3O and a molecular weight of 472.48 g/mol. Its IUPAC name is 1-[(3aS,4S,6aR)-2-(3-azaspiro[5.5]undecan-9-yl)-4-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;dihydrochloride.
| Compound Name | 1-[(3aS,4S,6aR)-2-(3-azaspiro[5.5]undecan-9-yl)-4-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171330084 |
| Molecular Formula | C24H36Cl2FN3O |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 1-[(3aS,4S,6aR)-2-(3-azaspiro[5.5]undecan-9-yl)-4-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;dihydrochloride |
| SMILES | CC(=O)N1C[C@H]2CN(C3CCC4(CCNCC4)CC3)C[C@H]2[C@H]1c1cccc(F)c1.Cl.Cl |
| InChI | InChI=1S/C24H34FN3O.2ClH/c1-17(29)28-15-19-14-27(16-22(19)23(28)18-3-2-4-20(25)13-18)21-5-7-24(8-6-21)9-11-26-12-10-24;;/h2-4,13,19,21-23,26H,5-12,14-16H2,1H3;2*1H/t19-,22-,23-;;/m1../s1 |
| InChIKey | DHQQOXTUKJJKMS-GKFBYOHMSA-N |
| XLogP | 4.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |