C18H21N3O4S — CID 166615852
[(3aS,4R,6aR)-5-methylsulfonyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(5-methyl-1,3-oxazol-4-yl)methanone (PubChem CID 166615852) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is [(3aS,4R,6aR)-5-methylsulfonyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(5-methyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(3aS,4R,6aR)-5-methylsulfonyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(5-methyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 166615852 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(3aS,4R,6aR)-5-methylsulfonyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(5-methyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1ocnc1C(=O)N1C[C@@H]2CN(S(C)(=O)=O)[C@@H](c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C18H21N3O4S/c1-12-16(19-11-25-12)18(22)20-8-14-9-21(26(2,23)24)17(15(14)10-20)13-6-4-3-5-7-13/h3-7,11,14-15,17H,8-10H2,1-2H3/t14-,15-,17+/m1/s1 |
| InChIKey | SFJLVBASGMDQFT-INMHGKMJSA-N |
| XLogP | 1.69 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |