C19H27N3O4S — CID 170508275
(3aR,4S,6aS)-N,N-dimethyl-2-(3-methyloxetane-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide (PubChem CID 170508275) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is (3aR,4S,6aS)-N,N-dimethyl-2-(3-methyloxetane-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide.
| Compound Name | (3aR,4S,6aS)-N,N-dimethyl-2-(3-methyloxetane-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide |
|---|---|
| PubChem CID | 170508275 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3aR,4S,6aS)-N,N-dimethyl-2-(3-methyloxetane-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1C[C@@H]2CN(C(=O)C3(C)COC3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H27N3O4S/c1-19(12-26-13-19)18(23)21-9-15-10-22(27(24,25)20(2)3)17(16(15)11-21)14-7-5-4-6-8-14/h4-8,15-17H,9-13H2,1-3H3/t15-,16-,17+/m0/s1 |
| InChIKey | APLQPYMHZGXURM-YESZJQIVSA-N |
| XLogP | 0.96 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |