C12H18N2O3S — CID 110740572
N,N,2-trimethyl-5-phenyl-1,3-oxazolidine-3-sulfonamide (PubChem CID 110740572) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N,N,2-trimethyl-5-phenyl-1,3-oxazolidine-3-sulfonamide.
| Compound Name | N,N,2-trimethyl-5-phenyl-1,3-oxazolidine-3-sulfonamide |
|---|---|
| PubChem CID | 110740572 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N,N,2-trimethyl-5-phenyl-1,3-oxazolidine-3-sulfonamide |
| SMILES | CC1OC(c2ccccc2)CN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H18N2O3S/c1-10-14(18(15,16)13(2)3)9-12(17-10)11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3 |
| InChIKey | OHVBBRSRUGNHEV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |