C13H19ClN2O3S — CID 99825537
(2R,5S)-2-(3-chlorophenyl)-N,N,5-trimethylmorpholine-4-sulfonamide (PubChem CID 99825537) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is (2R,5S)-2-(3-chlorophenyl)-N,N,5-trimethylmorpholine-4-sulfonamide.
| Compound Name | (2R,5S)-2-(3-chlorophenyl)-N,N,5-trimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 99825537 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (2R,5S)-2-(3-chlorophenyl)-N,N,5-trimethylmorpholine-4-sulfonamide |
| SMILES | C[C@H]1CO[C@H](c2cccc(Cl)c2)CN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H19ClN2O3S/c1-10-9-19-13(11-5-4-6-12(14)7-11)8-16(10)20(17,18)15(2)3/h4-7,10,13H,8-9H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | ZENSBFDYQYJKHE-GWCFXTLKSA-N |
| XLogP | 1.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |