C14H15ClFNO2 — CID 166417422
1-[2-(3-chlorophenyl)-5-methylmorpholin-4-yl]-2-fluoroprop-2-en-1-one (PubChem CID 166417422) has the molecular formula C14H15ClFNO2 and a molecular weight of 283.73 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-5-methylmorpholin-4-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[2-(3-chlorophenyl)-5-methylmorpholin-4-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 166417422 |
| Molecular Formula | C14H15ClFNO2 |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-5-methylmorpholin-4-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CC(c2cccc(Cl)c2)OCC1C |
| InChI | InChI=1S/C14H15ClFNO2/c1-9-8-19-13(7-17(9)14(18)10(2)16)11-4-3-5-12(15)6-11/h3-6,9,13H,2,7-8H2,1H3 |
| InChIKey | XARGMNRMWMOYBD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|