C12H19N3O2S — CID 94994297
(2R)-N,N-dimethyl-2-phenylpiperazine-1-sulfonamide (PubChem CID 94994297) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-phenylpiperazine-1-sulfonamide.
| Compound Name | (2R)-N,N-dimethyl-2-phenylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 94994297 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (2R)-N,N-dimethyl-2-phenylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCNC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H19N3O2S/c1-14(2)18(16,17)15-9-8-13-10-12(15)11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | UOPQLLMPEDGYRV-LBPRGKRZSA-N |
| XLogP | 0.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |