C12H18N2O2S — CID 82245286
1-methylsulfonyl-2-phenyl-1,4-diazepane (PubChem CID 82245286) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-methylsulfonyl-2-phenyl-1,4-diazepane.
| Compound Name | 1-methylsulfonyl-2-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 82245286 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-methylsulfonyl-2-phenyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCNCC1c1ccccc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-17(15,16)14-9-5-8-13-10-12(14)11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-10H2,1H3 |
| InChIKey | HGZIYFDROLNXRS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |