C18H22N4O4S — CID 126507736
methyl 6-[[(2-phenylpiperazin-1-yl)sulfonylamino]methyl]pyridine-3-carboxylate (PubChem CID 126507736) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is methyl 6-[[(2-phenylpiperazin-1-yl)sulfonylamino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[(2-phenylpiperazin-1-yl)sulfonylamino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126507736 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl 6-[[(2-phenylpiperazin-1-yl)sulfonylamino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)N2CCNCC2c2ccccc2)nc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-26-18(23)15-7-8-16(20-11-15)12-21-27(24,25)22-10-9-19-13-17(22)14-5-3-2-4-6-14/h2-8,11,17,19,21H,9-10,12-13H2,1H3 |
| InChIKey | PQVYGAOIQJAOCT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |