C19H23N3O4S — CID 120763641
methyl 3,4-dimethyl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 120763641) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 3,4-dimethyl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 3,4-dimethyl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 120763641 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 3,4-dimethyl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1cc(C)c(C)c(S(=O)(=O)N2CCNCC2c2cccnc2)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-13-9-16(19(23)26-3)10-18(14(13)2)27(24,25)22-8-7-21-12-17(22)15-5-4-6-20-11-15/h4-6,9-11,17,21H,7-8,12H2,1-3H3 |
| InChIKey | WOCCZNADFLCNNF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |