C18H22ClN3O5S — CID 120763532
methyl 4-methoxy-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate;hydrochloride (PubChem CID 120763532) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is methyl 4-methoxy-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate;hydrochloride.
| Compound Name | methyl 4-methoxy-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120763532 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | methyl 4-methoxy-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)N2CCNCC2c2cccnc2)c1.Cl |
| InChI | InChI=1S/C18H21N3O5S.ClH/c1-25-16-6-5-13(18(22)26-2)10-17(16)27(23,24)21-9-8-20-12-15(21)14-4-3-7-19-11-14;/h3-7,10-11,15,20H,8-9,12H2,1-2H3;1H |
| InChIKey | DDIJXGUSBWLTPB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |