C17H22N4O5S — CID 120894856
methyl 3-methoxy-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 120894856) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is methyl 3-methoxy-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 3-methoxy-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 120894856 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | methyl 3-methoxy-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCNCC2c2nccn2C)c(OC)c1 |
| InChI | InChI=1S/C17H22N4O5S/c1-20-8-7-19-16(20)13-11-18-6-9-21(13)27(23,24)15-5-4-12(17(22)26-3)10-14(15)25-2/h4-5,7-8,10,13,18H,6,9,11H2,1-3H3 |
| InChIKey | SZUKSGHSMKJLIL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |