C15H19ClN4O2S — CID 120894890
1-(5-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine (PubChem CID 120894890) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine.
| Compound Name | 1-(5-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 120894890 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CCNCC1c1nccn1C |
| InChI | InChI=1S/C15H19ClN4O2S/c1-11-3-4-12(16)9-14(11)23(21,22)20-8-5-17-10-13(20)15-18-6-7-19(15)2/h3-4,6-7,9,13,17H,5,8,10H2,1-2H3 |
| InChIKey | CJNXAMGMWMVXLO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |