C15H20Cl2N4O2S — CID 120895215
1-(3-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120895215) has the molecular formula C15H20Cl2N4O2S and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-(3-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120895215 |
| Molecular Formula | C15H20Cl2N4O2S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C15H19ClN4O2S.ClH/c1-11-12(16)4-3-5-14(11)23(21,22)20-9-6-17-10-13(20)15-18-7-8-19(15)2;/h3-5,7-8,13,17H,6,9-10H2,1-2H3;1H |
| InChIKey | DAMKPUGNGSTZJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |