C14H18Cl2N4O2S — CID 120894581
1-(2-chlorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120894581) has the molecular formula C14H18Cl2N4O2S and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120894581 |
| Molecular Formula | C14H18Cl2N4O2S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1S(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN4O2S.ClH/c1-18-8-7-17-14(18)12-10-16-6-9-19(12)22(20,21)13-5-3-2-4-11(13)15;/h2-5,7-8,12,16H,6,9-10H2,1H3;1H |
| InChIKey | BBORXIAVZCDXLX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |