C15H18ClFN4O2S — CID 120894952
1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine (PubChem CID 120894952) has the molecular formula C15H18ClFN4O2S and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine.
| Compound Name | 1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 120894952 |
| Molecular Formula | C15H18ClFN4O2S |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCNCC2c2nccn2C)c(Cl)cc1F |
| InChI | InChI=1S/C15H18ClFN4O2S/c1-10-7-14(11(16)8-12(10)17)24(22,23)21-6-3-18-9-13(21)15-19-4-5-20(15)2/h4-5,7-8,13,18H,3,6,9H2,1-2H3 |
| InChIKey | DJLHEORDBWTICA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |