C17H25ClN4O4S — CID 120894537
1-[2-(2-methoxyethoxy)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120894537) has the molecular formula C17H25ClN4O4S and a molecular weight of 416.93 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-[2-(2-methoxyethoxy)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120894537 |
| Molecular Formula | C17H25ClN4O4S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | COCCOc1ccccc1S(=O)(=O)N1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C17H24N4O4S.ClH/c1-20-9-8-19-17(20)14-13-18-7-10-21(14)26(22,23)16-6-4-3-5-15(16)25-12-11-24-2;/h3-6,8-9,14,18H,7,10-13H2,1-2H3;1H |
| InChIKey | LCZDDUCBGWVXPN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|