C17H25ClN4O3S — CID 120894479
1-[4-(2-methoxyethyl)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120894479) has the molecular formula C17H25ClN4O3S and a molecular weight of 400.93 g/mol. Its IUPAC name is 1-[4-(2-methoxyethyl)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-[4-(2-methoxyethyl)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120894479 |
| Molecular Formula | C17H25ClN4O3S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[4-(2-methoxyethyl)phenyl]sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | COCCc1ccc(S(=O)(=O)N2CCNCC2c2nccn2C)cc1.Cl |
| InChI | InChI=1S/C17H24N4O3S.ClH/c1-20-10-9-19-17(20)16-13-18-8-11-21(16)25(22,23)15-5-3-14(4-6-15)7-12-24-2;/h3-6,9-10,16,18H,7-8,11-13H2,1-2H3;1H |
| InChIKey | JAAMVIZWSDODDD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |