C14H16F2N4O2S — CID 120894696
1-(3,4-difluorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine (PubChem CID 120894696) has the molecular formula C14H16F2N4O2S and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 120894696 |
| Molecular Formula | C14H16F2N4O2S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine |
| SMILES | Cn1ccnc1C1CNCCN1S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H16F2N4O2S/c1-19-6-5-18-14(19)13-9-17-4-7-20(13)23(21,22)10-2-3-11(15)12(16)8-10/h2-3,5-6,8,13,17H,4,7,9H2,1H3 |
| InChIKey | TYAHGBLNRWEFQJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |