C15H20ClFN4O2S — CID 120894523
1-(3-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120894523) has the molecular formula C15H20ClFN4O2S and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-(3-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-(3-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120894523 |
| Molecular Formula | C15H20ClFN4O2S |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-(3-fluoro-5-methylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | Cc1cc(F)cc(S(=O)(=O)N2CCNCC2c2nccn2C)c1.Cl |
| InChI | InChI=1S/C15H19FN4O2S.ClH/c1-11-7-12(16)9-13(8-11)23(21,22)20-6-3-17-10-14(20)15-18-4-5-19(15)2;/h4-5,7-9,14,17H,3,6,10H2,1-2H3;1H |
| InChIKey | LZPBRDIEWJWRFQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |