C15H17Cl2N5O2S — CID 120895229
2-chloro-5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile;hydrochloride (PubChem CID 120895229) has the molecular formula C15H17Cl2N5O2S and a molecular weight of 402.31 g/mol. Its IUPAC name is 2-chloro-5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile;hydrochloride.
| Compound Name | 2-chloro-5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 120895229 |
| Molecular Formula | C15H17Cl2N5O2S |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 2-chloro-5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzonitrile;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1S(=O)(=O)c1ccc(Cl)c(C#N)c1 |
| InChI | InChI=1S/C15H16ClN5O2S.ClH/c1-20-6-5-19-15(20)14-10-18-4-7-21(14)24(22,23)12-2-3-13(16)11(8-12)9-17;/h2-3,5-6,8,14,18H,4,7,10H2,1H3;1H |
| InChIKey | LQPXALCQOLYHPR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |