C16H23ClN4O2S — CID 120895239
1-(4-ethylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120895239) has the molecular formula C16H23ClN4O2S and a molecular weight of 370.91 g/mol. Its IUPAC name is 1-(4-ethylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-(4-ethylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120895239 |
| Molecular Formula | C16H23ClN4O2S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-(4-ethylphenyl)sulfonyl-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | CCc1ccc(S(=O)(=O)N2CCNCC2c2nccn2C)cc1.Cl |
| InChI | InChI=1S/C16H22N4O2S.ClH/c1-3-13-4-6-14(7-5-13)23(21,22)20-11-8-17-12-15(20)16-18-9-10-19(16)2;/h4-7,9-10,15,17H,3,8,11-12H2,1-2H3;1H |
| InChIKey | SGRNRFPHTFXCJZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |