C14H18N4O4S2 — CID 120895246
methyl 5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylthiophene-3-carboxylate (PubChem CID 120895246) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is methyl 5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylthiophene-3-carboxylate.
| Compound Name | methyl 5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 120895246 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | methyl 5-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylthiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(S(=O)(=O)N2CCNCC2c2nccn2C)c1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-17-5-4-16-13(17)11-8-15-3-6-18(11)24(20,21)12-7-10(9-23-12)14(19)22-2/h4-5,7,9,11,15H,3,6,8H2,1-2H3 |
| InChIKey | WNTLQOORPJCIHF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |