C17H22N4O4S — CID 120895152
methyl 2-methyl-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 120895152) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is methyl 2-methyl-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 2-methyl-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 120895152 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | methyl 2-methyl-4-[2-(1-methylimidazol-2-yl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCNCC2c2nccn2C)cc1C |
| InChI | InChI=1S/C17H22N4O4S/c1-12-10-13(4-5-14(12)17(22)25-3)26(23,24)21-9-6-18-11-15(21)16-19-7-8-20(16)2/h4-5,7-8,10,15,18H,6,9,11H2,1-3H3 |
| InChIKey | KRPYWQRJQQZFFY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |