C22H28ClN4O4S+ — CID 126508853
methyl 6-[[[1-(3-chlorophenyl)-4-cyclobutylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate (PubChem CID 126508853) has the molecular formula C22H28ClN4O4S+ and a molecular weight of 480.01 g/mol. Its IUPAC name is methyl 6-[[[1-(3-chlorophenyl)-4-cyclobutylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[[1-(3-chlorophenyl)-4-cyclobutylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126508853 |
| Molecular Formula | C22H28ClN4O4S+ |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | methyl 6-[[[1-(3-chlorophenyl)-4-cyclobutylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)[N+]2(c3cccc(Cl)c3)CCN(C3CCC3)CC2)nc1 |
| InChI | InChI=1S/C22H28ClN4O4S/c1-31-22(28)17-8-9-19(24-15-17)16-25-32(29,30)27(21-7-2-4-18(23)14-21)12-10-26(11-13-27)20-5-3-6-20/h2,4,7-9,14-15,20,25H,3,5-6,10-13,16H2,1H3/q+1 |
| InChIKey | WUNBAHKPDQDYHU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|