C22H29N4O5S+ — CID 126509006
methyl 6-[[[(3S,5R)-4-acetyl-3,5-dimethyl-1-phenylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate (PubChem CID 126509006) has the molecular formula C22H29N4O5S+ and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 6-[[[(3S,5R)-4-acetyl-3,5-dimethyl-1-phenylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[[(3S,5R)-4-acetyl-3,5-dimethyl-1-phenylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126509006 |
| Molecular Formula | C22H29N4O5S+ |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | methyl 6-[[[(3S,5R)-4-acetyl-3,5-dimethyl-1-phenylpiperazin-1-ium-1-yl]sulfonylamino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)[N+]2(c3ccccc3)C[C@@H](C)N(C(C)=O)[C@@H](C)C2)nc1 |
| InChI | InChI=1S/C22H29N4O5S/c1-16-14-26(21-8-6-5-7-9-21,15-17(2)25(16)18(3)27)32(29,30)24-13-20-11-10-19(12-23-20)22(28)31-4/h5-12,16-17,24H,13-15H2,1-4H3/q+1/t16-,17+,26? |
| InChIKey | XRRHSLGPMAYUKM-QUZBXDHSSA-N |
| XLogP | 1.85 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|