C21H28N3O4S+ — CID 126507684
methyl 6-[[3-(1-phenylpyrrolidin-1-ium-1-yl)propylsulfonylamino]methyl]pyridine-3-carboxylate (PubChem CID 126507684) has the molecular formula C21H28N3O4S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is methyl 6-[[3-(1-phenylpyrrolidin-1-ium-1-yl)propylsulfonylamino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-(1-phenylpyrrolidin-1-ium-1-yl)propylsulfonylamino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126507684 |
| Molecular Formula | C21H28N3O4S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | methyl 6-[[3-(1-phenylpyrrolidin-1-ium-1-yl)propylsulfonylamino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)CCC[N+]2(c3ccccc3)CCCC2)nc1 |
| InChI | InChI=1S/C21H28N3O4S/c1-28-21(25)18-10-11-19(22-16-18)17-23-29(26,27)15-7-14-24(12-5-6-13-24)20-8-3-2-4-9-20/h2-4,8-11,16,23H,5-7,12-15,17H2,1H3/q+1 |
| InChIKey | YUFPQGJGILCZBD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|