C23H31FN3O4S+ — CID 126507272
methyl 3-fluoro-4-[[3-(4-methyl-1-phenylpiperazin-1-ium-1-yl)propylsulfonylamino]methyl]benzoate (PubChem CID 126507272) has the molecular formula C23H31FN3O4S+ and a molecular weight of 464.58 g/mol. Its IUPAC name is methyl 3-fluoro-4-[[3-(4-methyl-1-phenylpiperazin-1-ium-1-yl)propylsulfonylamino]methyl]benzoate.
| Compound Name | methyl 3-fluoro-4-[[3-(4-methyl-1-phenylpiperazin-1-ium-1-yl)propylsulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 126507272 |
| Molecular Formula | C23H31FN3O4S+ |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | methyl 3-fluoro-4-[[3-(4-methyl-1-phenylpiperazin-1-ium-1-yl)propylsulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)CCC[N+]2(c3ccccc3)CCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C23H31FN3O4S/c1-26-11-14-27(15-12-26,21-7-4-3-5-8-21)13-6-16-32(29,30)25-18-20-10-9-19(17-22(20)24)23(28)31-2/h3-5,7-10,17,25H,6,11-16,18H2,1-2H3/q+1 |
| InChIKey | YJVJKIIEPAGUJZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|